CAS 942947-95-7 appears in our catalog under these names: 2-Amino-5-bromo-4-chloro-3-nitropyridine 97%, 2-Amino-5-bromo-4-chloro-3-nitropyridine, 98%, 98%, 2-Amino-5-bromo-4-chloro-3-nitropyridine, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 500g, 250mg, 1g, 5g, 25g, 100g, 100mg, 10g.
5-bromo-4-chloro-3-nitropyridin-2-amine (CAS 942947-95-7) is a chemical compound with the molecular formula C5H3BrClN3O2 and a molecular weight of 252.45 g/mol. IUPAC name: 5-bromo-4-chloro-3-nitropyridin-2-amine. InChIKey: BLGCPXIDEMLKMS-UHFFFAOYSA-N.
| Molecular formula | C5H3BrClN3O2 |
|---|---|
| Molecular weight | 252.45 g/mol |
| IUPAC name | 5-bromo-4-chloro-3-nitropyridin-2-amine |
| InChIKey | BLGCPXIDEMLKMS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)N)[N+](=O)[O-])Cl)Br |
Computed by PubChem (NCBI)