CAS 1936339-56-8 is the registry number for 5-(3,4-Difluorophenyl)-1H-1,2,3-triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3,4-difluorophenyl)-2H-triazole (CAS 1936339-56-8) is a chemical compound with the molecular formula C8H5F2N3 and a molecular weight of 181.14 g/mol. IUPAC name: 4-(3,4-difluorophenyl)-2H-triazole. InChIKey: YIFMCPBILKOQPE-UHFFFAOYSA-N.
| Molecular formula | C8H5F2N3 |
|---|---|
| Molecular weight | 181.14 g/mol |
| IUPAC name | 4-(3,4-difluorophenyl)-2H-triazole |
| InChIKey | YIFMCPBILKOQPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NNN=C2)F)F |
Computed by PubChem (NCBI)