CAS 95728-14-6 is the registry number for 5-(2,4-Difluorophenyl)-1H-1,2,4-triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,4-difluorophenyl)-1H-1,2,4-triazole (CAS 95728-14-6) is a chemical compound with the molecular formula C8H5F2N3 and a molecular weight of 181.14 g/mol. IUPAC name: 5-(2,4-difluorophenyl)-1H-1,2,4-triazole. InChIKey: NUBPMSDTWXBOKT-UHFFFAOYSA-N.
| Molecular formula | C8H5F2N3 |
|---|---|
| Molecular weight | 181.14 g/mol |
| IUPAC name | 5-(2,4-difluorophenyl)-1H-1,2,4-triazole |
| InChIKey | NUBPMSDTWXBOKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=NC=NN2 |
Computed by PubChem (NCBI)