CAS 19368-24-2 is the registry number for 3',4'–DICHLOROPHTHALANILIC ACID. Offered by: GLPBio. Available pack sizes: 50mg.
2-[(3,4-dichlorophenyl)carbamoyl]benzoic acid (CAS 19368-24-2) is a chemical compound with the molecular formula C14H9Cl2NO3 and a molecular weight of 310.1 g/mol. IUPAC name: 2-[(3,4-dichlorophenyl)carbamoyl]benzoic acid. InChIKey: IJDPTPLIVARLPT-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2NO3 |
|---|---|
| Molecular weight | 310.1 g/mol |
| IUPAC name | 2-[(3,4-dichlorophenyl)carbamoyl]benzoic acid |
| InChIKey | IJDPTPLIVARLPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)