CAS 1937-54-8 is the registry number for Solanone. Offered by: Biosynth. Available pack sizes: 10g, 5g, 25g, 50g, 100g.
(5S,6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-one (CAS 1937-54-8) is a chemical compound with the molecular formula C13H22O and a molecular weight of 194.31 g/mol. IUPAC name: (5S,6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-one. InChIKey: PQDRXUSSKFWCFA-CFNZNRNTSA-N.
| Molecular formula | C13H22O |
|---|---|
| Molecular weight | 194.31 g/mol |
| IUPAC name | (5S,6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-one |
| InChIKey | PQDRXUSSKFWCFA-CFNZNRNTSA-N |
| SMILES | CC(C)[C@H](CCC(=O)C)/C=C/C(=C)C |
Computed by PubChem (NCBI)