CAS 1937274-84-4 is the registry number for 2-((Hydroxyimino)methyl)-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(E)-hydroxyiminomethyl]-1,3-thiazole-5-carboxylic acid (CAS 1937274-84-4) is a chemical compound with the molecular formula C5H4N2O3S and a molecular weight of 172.16 g/mol. IUPAC name: 2-[(E)-hydroxyiminomethyl]-1,3-thiazole-5-carboxylic acid. InChIKey: HSFADGKEDQBIDN-FARCUNLSSA-N.
| Molecular formula | C5H4N2O3S |
|---|---|
| Molecular weight | 172.16 g/mol |
| IUPAC name | 2-[(E)-hydroxyiminomethyl]-1,3-thiazole-5-carboxylic acid |
| InChIKey | HSFADGKEDQBIDN-FARCUNLSSA-N |
| SMILES | C1=C(SC(=N1)/C=N/O)C(=O)O |
Computed by PubChem (NCBI)