CAS 73150-67-1 appears in our catalog under these names: 2-(2-Aminothiazol-4-yl)glyoxylic acid, 95%, 2-Amino-4-thiazoleglyoxylic Acid, 2–(2–Aminothiazol–4–yl)–2–oxoacetic acid, 2-(2-Aminothiazol-4-yl)-2-oxoacetic acid 95%, 2-(2-Aminothiazol-4-Yl)-2-Oxoacetic Acid, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, 25g, 100mg, 250mg.
2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetic acid (CAS 73150-67-1) is a chemical compound with the molecular formula C5H4N2O3S and a molecular weight of 172.16 g/mol. IUPAC name: 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetic acid. InChIKey: VMASTYPGLHRVNL-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3S |
|---|---|
| Molecular weight | 172.16 g/mol |
| IUPAC name | 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetic acid |
| InChIKey | VMASTYPGLHRVNL-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)N)C(=O)C(=O)O |
Computed by PubChem (NCBI)