CAS 1937362-45-2 is the registry number for Olaparib Impurity 70. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-5-[(E)-hydrazinylidenemethyl]benzonitrile (CAS 1937362-45-2) is a chemical compound with the molecular formula C8H6FN3 and a molecular weight of 163.15 g/mol. IUPAC name: 2-fluoro-5-[(E)-hydrazinylidenemethyl]benzonitrile. InChIKey: WHIJZVMEPLNUPL-LFYBBSHMSA-N.
| Molecular formula | C8H6FN3 |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 2-fluoro-5-[(E)-hydrazinylidenemethyl]benzonitrile |
| InChIKey | WHIJZVMEPLNUPL-LFYBBSHMSA-N |
| SMILES | C1=CC(=C(C=C1/C=N/N)C#N)F |
Computed by PubChem (NCBI)