Products 1938080-42-2
CAS 1938080-42-2 appears in our catalog under these names: Trelagliptin Impurity 6, Alogliptin Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-2-[(3-methyl-2,4,6-trioxo-1,3-diazinan-1-yl)methyl]benzonitrile (CAS 1938080-42-2) is a chemical compound with the molecular formula C13H10FN3O3 and a molecular weight of 275.23 g/mol. IUPAC name: 4-fluoro-2-[(3-methyl-2,4,6-trioxo-1,3-diazinan-1-yl)methyl]benzonitrile. InChIKey: QMYHDPMNTSJPGG-UHFFFAOYSA-N.
| Molecular formula | C13H10FN3O3 |
|---|---|
| Molecular weight | 275.23 g/mol |
| IUPAC name | 4-fluoro-2-[(3-methyl-2,4,6-trioxo-1,3-diazinan-1-yl)methyl]benzonitrile |
| InChIKey | QMYHDPMNTSJPGG-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC(=O)N(C1=O)CC2=C(C=CC(=C2)F)C#N |
Computed by PubChem (NCBI)
Synonyms:
Trelagliptin Impurity 6, Trelagliptin Impurity 28