CAS 84378-44-9 appears in our catalog under these names: Flumazenil EP Impurity A, Flumazenil Carboxylic Acid, >95% (HPLC), 8-Fluoro-5-methyl-6-oxo-5,6-dihydro-4H-imidazo(1,5-a)(1,4)benzodiazepine-3-carboxylic Acid, Flumazenil acid 99%, Ro 15-3890, 99%, 99%. Offered by: Chemat Brand, TRC, Mikromol, Ambeed, Chemat. Available pack sizes: on request, 100mg, 10mg, 25mg, 1mg, 5mg, 50mg, 250mg.
8-fluoro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylic acid (CAS 84378-44-9) is a chemical compound with the molecular formula C13H10FN3O3 and a molecular weight of 275.23 g/mol. IUPAC name: 8-fluoro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylic acid. InChIKey: SFVXVWJBSJCRJO-UHFFFAOYSA-N.
| Molecular formula | C13H10FN3O3 |
|---|---|
| Molecular weight | 275.23 g/mol |
| IUPAC name | 8-fluoro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylic acid |
| InChIKey | SFVXVWJBSJCRJO-UHFFFAOYSA-N |
| SMILES | CN1CC2=C(N=CN2C3=C(C1=O)C=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)