CAS 1939-19-1 appears in our catalog under these names: 3-(Trifluoromethyl)pivalanilide, N-(3-(Trifluoromethyl)phenyl)pivalamide, 97%, 97%. Offered by: TRC, Chemat. Available pack sizes: 10g, 1g, 100mg, 250mg.
2,2-dimethyl-N-[3-(trifluoromethyl)phenyl]propanamide (CAS 1939-19-1) is a chemical compound with the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. IUPAC name: 2,2-dimethyl-N-[3-(trifluoromethyl)phenyl]propanamide. InChIKey: AGOPRFPFSYTJNX-UHFFFAOYSA-N.
| Molecular formula | C12H14F3NO |
|---|---|
| Molecular weight | 245.24 g/mol |
| IUPAC name | 2,2-dimethyl-N-[3-(trifluoromethyl)phenyl]propanamide |
| InChIKey | AGOPRFPFSYTJNX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC=CC(=C1)C(F)(F)F |
Computed by PubChem (NCBI)