CAS 1939277-76-5 is the registry number for 1-(2,6-Difluoro-3-methylphenyl)-2,2,3,3,3-pentafluoro-1-propanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,6-difluoro-3-methylphenyl)-2,2,3,3,3-pentafluoropropan-1-one (CAS 1939277-76-5) is a chemical compound with the molecular formula C10H5F7O and a molecular weight of 274.13 g/mol. IUPAC name: 1-(2,6-difluoro-3-methylphenyl)-2,2,3,3,3-pentafluoropropan-1-one. InChIKey: ABKJGKBJFXNOGS-UHFFFAOYSA-N.
| Molecular formula | C10H5F7O |
|---|---|
| Molecular weight | 274.13 g/mol |
| IUPAC name | 1-(2,6-difluoro-3-methylphenyl)-2,2,3,3,3-pentafluoropropan-1-one |
| InChIKey | ABKJGKBJFXNOGS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)C(=O)C(C(F)(F)F)(F)F)F |
Computed by PubChem (NCBI)