CAS 875306-42-6 is the registry number for 4-(Heptafluoropropan-2-yl)benzaldehyde. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzaldehyde (CAS 875306-42-6) is a chemical compound with the molecular formula C10H5F7O and a molecular weight of 274.13 g/mol. IUPAC name: 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzaldehyde. InChIKey: WYIPEGIQFRQBAA-UHFFFAOYSA-N.
| Molecular formula | C10H5F7O |
|---|---|
| Molecular weight | 274.13 g/mol |
| IUPAC name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzaldehyde |
| InChIKey | WYIPEGIQFRQBAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C(C(F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)