CAS 32428-75-4 appears in our catalog under these names: 2-Bromo-N-(2,6-dichlorophenyl)acetamide, 95%, 2-Bromo-N-(2,6-dichlorophenyl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-bromo-N-(2,6-dichlorophenyl)acetamide (CAS 32428-75-4) is a chemical compound with the molecular formula C8H6BrCl2NO and a molecular weight of 282.95 g/mol. IUPAC name: 2-bromo-N-(2,6-dichlorophenyl)acetamide. InChIKey: ONXFMNDUDDOUGJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrCl2NO |
|---|---|
| Molecular weight | 282.95 g/mol |
| IUPAC name | 2-bromo-N-(2,6-dichlorophenyl)acetamide |
| InChIKey | ONXFMNDUDDOUGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)NC(=O)CBr)Cl |
Computed by PubChem (NCBI)