Products 19402-64-3
CAS 19402-64-3 appears in our catalog under these names: Ammonium benzenesulfonate, Ammonium benzenesulfonate, Ammonium benzenesulfonate, 97%, 97%, Ammonium benzenesulfonate, 97%, Ammonium benzenesulfonate, 98%. Offered by: GLPBio, Biosynth, Chemat, Ambeed, BLDpharm. Available pack sizes: 100g, 25g, 5g, 10g, 50g, 250mg, 1g, 500g.
Azane;benzenesulfonic acid (CAS 19402-64-3) is a chemical compound with the molecular formula C6H9NO3S and a molecular weight of 175.21 g/mol. IUPAC name: azane;benzenesulfonic acid. InChIKey: WWLOCCUNZXBJFR-UHFFFAOYSA-N.
| Molecular formula | C6H9NO3S |
|---|---|
| Molecular weight | 175.21 g/mol |
| IUPAC name | azane;benzenesulfonic acid |
| InChIKey | WWLOCCUNZXBJFR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)O.N |
Computed by PubChem (NCBI)