CAS 79466-05-0 is the registry number for (3S,6S)-6-Methyl-5-oxothiomorpholine-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,6S)-6-methyl-5-oxothiomorpholine-3-carboxylic acid (CAS 79466-05-0) is a chemical compound with the molecular formula C6H9NO3S and a molecular weight of 175.21 g/mol. IUPAC name: (3S,6S)-6-methyl-5-oxothiomorpholine-3-carboxylic acid. InChIKey: QJFTZLOJRRSNEI-IUYQGCFVSA-N.
| Molecular formula | C6H9NO3S |
|---|---|
| Molecular weight | 175.21 g/mol |
| IUPAC name | (3S,6S)-6-methyl-5-oxothiomorpholine-3-carboxylic acid |
| InChIKey | QJFTZLOJRRSNEI-IUYQGCFVSA-N |
| SMILES | C[C@H]1C(=O)N[C@H](CS1)C(=O)O |
Computed by PubChem (NCBI)