CAS 194028-93-8 is the registry number for tert-Butyl (3-oxo-2,3-dihydro-1H-inden-5-yl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-(3-oxo-1,2-dihydroinden-5-yl)carbamate (CAS 194028-93-8) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: tert-butyl N-(3-oxo-1,2-dihydroinden-5-yl)carbamate. InChIKey: SVWIEYYTVDIDOU-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | tert-butyl N-(3-oxo-1,2-dihydroinden-5-yl)carbamate |
| InChIKey | SVWIEYYTVDIDOU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC2=C(CCC2=O)C=C1 |
Computed by PubChem (NCBI)