CAS 194039-81-1 is the registry number for Sevoflurane Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethoxy)propane (CAS 194039-81-1) is a chemical compound with the molecular formula C7H4F12O2 and a molecular weight of 348.09 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethoxy)propane. InChIKey: OHHWIUWMPLFBMA-UHFFFAOYSA-N.
| Molecular formula | C7H4F12O2 |
|---|---|
| Molecular weight | 348.09 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethoxy)propane |
| InChIKey | OHHWIUWMPLFBMA-UHFFFAOYSA-N |
| SMILES | C(OC(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)