CAS 812-87-3 appears in our catalog under these names: 7H–Dodecafluoroheptanealdehyde hydrate, 7H-Dodecafluoroheptanealdehyde hydrate, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 25g, 5g.
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptane-1,1-diol (CAS 812-87-3) is a chemical compound with the molecular formula C7H4F12O2 and a molecular weight of 348.09 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptane-1,1-diol. InChIKey: CTPJWMXVKNDLCK-UHFFFAOYSA-N.
| Molecular formula | C7H4F12O2 |
|---|---|
| Molecular weight | 348.09 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptane-1,1-diol |
| InChIKey | CTPJWMXVKNDLCK-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(O)O |
Computed by PubChem (NCBI)