CAS 19420-29-2 is the registry number for 2-Phenoxynaphthalene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
2-phenoxynaphthalene (CAS 19420-29-2) is a chemical compound with the molecular formula C16H12O and a molecular weight of 220.26 g/mol. IUPAC name: 2-phenoxynaphthalene. InChIKey: IYDAQAZENRCVOL-UHFFFAOYSA-N.
| Molecular formula | C16H12O |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 2-phenoxynaphthalene |
| InChIKey | IYDAQAZENRCVOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)