Products 19431-84-6
CAS 19431-84-6 appears in our catalog under these names: Curcumenol/ 98%, Curcumenol, Curcumenol, 99.98%, Curcumenol (Standard). Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1mg, 10mM (in 1ml dmso).
(1S,2S,5S,8R)-2,6-dimethyl-9-propan-2-ylidene-11-oxatricyclo[6.2.1.01,5]undec-6-en-8-ol (CAS 19431-84-6) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: (1S,2S,5S,8R)-2,6-dimethyl-9-propan-2-ylidene-11-oxatricyclo[6.2.1.01,5]undec-6-en-8-ol. InChIKey: ISFMXVMWEWLJGJ-NZBPQXDJSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | (1S,2S,5S,8R)-2,6-dimethyl-9-propan-2-ylidene-11-oxatricyclo[6.2.1.01,5]undec-6-en-8-ol |
| InChIKey | ISFMXVMWEWLJGJ-NZBPQXDJSA-N |
| SMILES | C[C@H]1CC[C@@H]2[C@]13CC(=C(C)C)[C@](O3)(C=C2C)O |
Computed by PubChem (NCBI)