CAS 19434-42-5 appears in our catalog under these names: 5–Amino–(1,1'–biphenyl)–2–ol, 5-Amino-[1,1'-biphenyl]-2-ol 97%, 4-Amino-2-Phenylphenol, 5-Amino-[1,1'-biphenyl]-2-ol, 95%, 95%, 4-Amino-2-phenylphenol, 96%. Offered by: GLPBio, Ambeed, Chemat Brand, Biosynth, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, on request, 500mg.
4-amino-2-phenylphenol (CAS 19434-42-5) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: 4-amino-2-phenylphenol. InChIKey: OUIITAOCYATDMY-UHFFFAOYSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 4-amino-2-phenylphenol |
| InChIKey | OUIITAOCYATDMY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)N)O |
Computed by PubChem (NCBI)