CAS 194344-28-0 is the registry number for 3,3'-Dinitro-5,5'-bis(trifluoromethyl)biphenyl, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-nitro-3-[3-nitro-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)benzene (CAS 194344-28-0) is a chemical compound with the molecular formula C14H6F6N2O4 and a molecular weight of 380.20 g/mol. IUPAC name: 1-nitro-3-[3-nitro-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)benzene. InChIKey: NHEDTONHCGHJCX-UHFFFAOYSA-N.
| Molecular formula | C14H6F6N2O4 |
|---|---|
| Molecular weight | 380.20 g/mol |
| IUPAC name | 1-nitro-3-[3-nitro-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)benzene |
| InChIKey | NHEDTONHCGHJCX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)[N+](=O)[O-])C2=CC(=CC(=C2)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)