CAS 363-95-1 is the registry number for 4,4'-Dinitro-3,3'-bis(trifluoromethyl)biphenyl, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-nitro-4-[4-nitro-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)benzene (CAS 363-95-1) is a chemical compound with the molecular formula C14H6F6N2O4 and a molecular weight of 380.20 g/mol. IUPAC name: 1-nitro-4-[4-nitro-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)benzene. InChIKey: XTBWIABPTZDUPM-UHFFFAOYSA-N.
| Molecular formula | C14H6F6N2O4 |
|---|---|
| Molecular weight | 380.20 g/mol |
| IUPAC name | 1-nitro-4-[4-nitro-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)benzene |
| InChIKey | XTBWIABPTZDUPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)[N+](=O)[O-])C(F)(F)F)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)