CAS 194594-23-5 appears in our catalog under these names: (2S)-1-tert-Butyl 2-ethyl 5-hydroxypyrrolidine-1,2-dicarboxylate, (2S)-1-tert-Butyl 2-ethyl 5-hydroxypyrrolidine-1,2-dicarboxylate, 95+%, 1–(tert–Butyl) 2–ethyl (2S)–5–hydroxypyrrolidine–1,2–dicarboxylate. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g, 5g.
1-O-tert-butyl 2-O-ethyl (2S)-5-hydroxypyrrolidine-1,2-dicarboxylate (CAS 194594-23-5) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2S)-5-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: YEBCMUBWXIBWMU-IENPIDJESA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2S)-5-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | YEBCMUBWXIBWMU-IENPIDJESA-N |
| SMILES | CCOC(=O)[C@@H]1CCC(N1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)