Products 194799-59-2

CAS 194799-59-2 is the registry number for Levodropropizine Impurity 6. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

4-(4-methylpiperazin-1-yl)aniline;hydrochloride (CAS 194799-59-2) is a chemical compound with the molecular formula C11H18ClN3 and a molecular weight of 227.73 g/mol. IUPAC name: 4-(4-methylpiperazin-1-yl)aniline;hydrochloride. InChIKey: NOUGUHFQRDXEFF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18ClN3
Molecular weight227.73 g/mol
IUPAC name4-(4-methylpiperazin-1-yl)aniline;hydrochloride
InChIKeyNOUGUHFQRDXEFF-UHFFFAOYSA-N
SMILESCN1CCN(CC1)C2=CC=C(C=C2)N.Cl

Computed by PubChem (NCBI)