Products 2760487-02-1
CAS 2760487-02-1 is the registry number for rel-6-((2S,5R)-5-Methylpiperidin-2-yl)pyridin-3-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-[(2S,5R)-5-methylpiperidin-2-yl]pyridin-3-amine;hydrochloride (CAS 2760487-02-1) is a chemical compound with the molecular formula C11H18ClN3 and a molecular weight of 227.73 g/mol. IUPAC name: 6-[(2S,5R)-5-methylpiperidin-2-yl]pyridin-3-amine;hydrochloride. InChIKey: POWGQVDBWQNTCW-SCYNACPDSA-N.
| Molecular formula | C11H18ClN3 |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 6-[(2S,5R)-5-methylpiperidin-2-yl]pyridin-3-amine;hydrochloride |
| InChIKey | POWGQVDBWQNTCW-SCYNACPDSA-N |
| SMILES | C[C@@H]1CC[C@H](NC1)C2=NC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)