CAS 1948-71-6 appears in our catalog under these names: N-Acetyl-L-tyrosine Amide, Ac–Tyr–NH₂, Acetyl-L-tyrosine amide, Ac-Tyr-NH2, (S)-2-Acetamido-3-(4-hydroxyphenyl)propanamide, 98%, 98%. Offered by: TRC, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 2g, 5g, 1000mg, 0,1g, 500mg, 2000mg.
(2S)-2-acetamido-3-(4-hydroxyphenyl)propanamide (CAS 1948-71-6) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: (2S)-2-acetamido-3-(4-hydroxyphenyl)propanamide. InChIKey: RJNKBEQRBIJDNM-JTQLQIEISA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (2S)-2-acetamido-3-(4-hydroxyphenyl)propanamide |
| InChIKey | RJNKBEQRBIJDNM-JTQLQIEISA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N |
Computed by PubChem (NCBI)