CAS 1948237-21-5 is the registry number for 1-(3-Chloro-5-fluoropyridin-2-yl)ethanamine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
1-(3-chloro-5-fluoro-2-pyridinyl)ethanamine;hydrochloride (CAS 1948237-21-5) is a chemical compound with the molecular formula C7H9Cl2FN2 and a molecular weight of 211.06 g/mol. IUPAC name: 1-(3-chloro-5-fluoro-2-pyridinyl)ethanamine;hydrochloride. InChIKey: PKBYMBHCMFPZTQ-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2FN2 |
|---|---|
| Molecular weight | 211.06 g/mol |
| IUPAC name | 1-(3-chloro-5-fluoro-2-pyridinyl)ethanamine;hydrochloride |
| InChIKey | PKBYMBHCMFPZTQ-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=N1)F)Cl)N.Cl |
Computed by PubChem (NCBI)