CAS 2411592-14-6 is the registry number for (R)-1-(5-CHLORO-3-FLUOROPYRIDIN-2-YL)ETHAN-1-AMINE HCL, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1R)-1-(5-chloro-3-fluoro-2-pyridinyl)ethanamine;hydrochloride (CAS 2411592-14-6) is a chemical compound with the molecular formula C7H9Cl2FN2 and a molecular weight of 211.06 g/mol. IUPAC name: (1R)-1-(5-chloro-3-fluoro-2-pyridinyl)ethanamine;hydrochloride. InChIKey: GFTKPZSXCLYPIL-PGMHMLKASA-N.
| Molecular formula | C7H9Cl2FN2 |
|---|---|
| Molecular weight | 211.06 g/mol |
| IUPAC name | (1R)-1-(5-chloro-3-fluoro-2-pyridinyl)ethanamine;hydrochloride |
| InChIKey | GFTKPZSXCLYPIL-PGMHMLKASA-N |
| SMILES | C[C@H](C1=C(C=C(C=N1)Cl)F)N.Cl |
Computed by PubChem (NCBI)