CAS 194934-95-7 is the registry number for O-tert-Butyl-3-keto Fluvastatin. Offered by: TRC. Available pack sizes: 25mg.
Tert-butyl (E)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-5-hydroxy-3-oxohept-6-enoate (CAS 194934-95-7) is a chemical compound with the molecular formula C28H32FNO4 and a molecular weight of 465.6 g/mol. IUPAC name: tert-butyl (E)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-5-hydroxy-3-oxohept-6-enoate. InChIKey: CHEYRYWZYKYUHU-CCEZHUSRSA-N.
| Molecular formula | C28H32FNO4 |
|---|---|
| Molecular weight | 465.6 g/mol |
| IUPAC name | tert-butyl (E)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-5-hydroxy-3-oxohept-6-enoate |
| InChIKey | CHEYRYWZYKYUHU-CCEZHUSRSA-N |
| SMILES | CC(C)N1C2=CC=CC=C2C(=C1/C=C/C(CC(=O)CC(=O)OC(C)(C)C)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)