CAS 194935-02-9 is the registry number for 5-Keto-O-tert-butyl Fluvastatin. Offered by: TRC. Available pack sizes: 100mg.
Tert-butyl (E,3S)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3-hydroxy-5-oxohept-6-enoate (CAS 194935-02-9) is a chemical compound with the molecular formula C28H32FNO4 and a molecular weight of 465.6 g/mol. IUPAC name: tert-butyl (E,3S)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3-hydroxy-5-oxohept-6-enoate. InChIKey: IZJOKSSEMQWDSZ-FRFYRWIFSA-N.
| Molecular formula | C28H32FNO4 |
|---|---|
| Molecular weight | 465.6 g/mol |
| IUPAC name | tert-butyl (E,3S)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3-hydroxy-5-oxohept-6-enoate |
| InChIKey | IZJOKSSEMQWDSZ-FRFYRWIFSA-N |
| SMILES | CC(C)N1C2=CC=CC=C2C(=C1/C=C/C(=O)C[C@@H](CC(=O)OC(C)(C)C)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)