CAS 1950-69-2 appears in our catalog under these names: 4-Methylbenzene-1-sulfonyl bromide, 95-<97%, 4-Methylbenzene-1-sulfonyl bromide, 95%(LC-MS),RG. Offered by: Hoffman Fine Chemicals, Fluorochem. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 1g.
4-methylbenzenesulfonyl bromide (CAS 1950-69-2) is a chemical compound with the molecular formula C7H7BrO2S and a molecular weight of 235.10 g/mol. IUPAC name: 4-methylbenzenesulfonyl bromide. InChIKey: NTSFJZORNYYLFW-UHFFFAOYSA-N.
| Molecular formula | C7H7BrO2S |
|---|---|
| Molecular weight | 235.10 g/mol |
| IUPAC name | 4-methylbenzenesulfonyl bromide |
| InChIKey | NTSFJZORNYYLFW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)Br |
Computed by PubChem (NCBI)