CAS 19501-89-4 appears in our catalog under these names: 3,3,7-Trimethylindolin-2-one, 97%, 2H-Indol-2-one,1,3-dihydro-3,3,7-trimethyl-, 95%, 95%, 3,3,7-Trimethylindolin-2-one, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g, 2.5g.
3,3,7-trimethyl-1H-indol-2-one (CAS 19501-89-4) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 3,3,7-trimethyl-1H-indol-2-one. InChIKey: MWOVEBYJRFGAKQ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 3,3,7-trimethyl-1H-indol-2-one |
| InChIKey | MWOVEBYJRFGAKQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(C(=O)N2)(C)C |
Computed by PubChem (NCBI)