Products 39965-06-5
CAS 39965-06-5 is the registry number for Victoxinine. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, Get quote.
2-[(1R,3S,7R,8S,9S)-1-methyl-2-methylidene-9-propan-2-yl-5-azatricyclo[5.4.0.03,8]undecan-5-yl]ethanol (CAS 39965-06-5) is a chemical compound with the molecular formula C17H29NO and a molecular weight of 263.4 g/mol. IUPAC name: 2-[(1R,3S,7R,8S,9S)-1-methyl-2-methylidene-9-propan-2-yl-5-azatricyclo[5.4.0.03,8]undecan-5-yl]ethanol. InChIKey: DROLRDZYPMOKLM-BIVLZKPYSA-N.
| Molecular formula | C17H29NO |
|---|---|
| Molecular weight | 263.4 g/mol |
| IUPAC name | 2-[(1R,3S,7R,8S,9S)-1-methyl-2-methylidene-9-propan-2-yl-5-azatricyclo[5.4.0.03,8]undecan-5-yl]ethanol |
| InChIKey | DROLRDZYPMOKLM-BIVLZKPYSA-N |
| SMILES | CC(C)[C@@H]1CC[C@@]2([C@H]3[C@@H]1[C@@H](C2=C)CN(C3)CCO)C |
Computed by PubChem (NCBI)
Synonyms:
Victoxinine, VICTOXININE, (+)-