Products 1951425-19-6
CAS 1951425-19-6 is the registry number for (1R,3S)-Ethyl 3-((r)-1-phenylethylamino)cyclopentanecarboxylate hydrochloride, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Cis-ethyl (1R,3S)-3-[[(1R)-1-phenylethyl]amino]cyclopentane-1-carboxylate;hydrochloride (CAS 1951425-19-6) is a chemical compound with the molecular formula C16H24ClNO2 and a molecular weight of 297.82 g/mol. IUPAC name: cis-ethyl (1R,3S)-3-[[(1R)-1-phenylethyl]amino]cyclopentane-1-carboxylate;hydrochloride. InChIKey: YOJNYTKDNMOHJF-LJGQPXTLSA-N.
| Molecular formula | C16H24ClNO2 |
|---|---|
| Molecular weight | 297.82 g/mol |
| IUPAC name | cis-ethyl (1R,3S)-3-[[(1R)-1-phenylethyl]amino]cyclopentane-1-carboxylate;hydrochloride |
| InChIKey | YOJNYTKDNMOHJF-LJGQPXTLSA-N |
| SMILES | CCOC(=O)[C@@H]1CC[C@@H](C1)N[C@H](C)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)