Products 649747-95-5

CAS 649747-95-5 is the registry number for Benzyl 2-(1-(aminomethyl)cyclohexyl)acetate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Benzyl 2-[1-(aminomethyl)cyclohexyl]acetate;hydrochloride (CAS 649747-95-5) is a chemical compound with the molecular formula C16H24ClNO2 and a molecular weight of 297.82 g/mol. IUPAC name: benzyl 2-[1-(aminomethyl)cyclohexyl]acetate;hydrochloride. InChIKey: ATPWCBUPVVFSTB-UHFFFAOYSA-N.

Identity
Molecular formulaC16H24ClNO2
Molecular weight297.82 g/mol
IUPAC namebenzyl 2-[1-(aminomethyl)cyclohexyl]acetate;hydrochloride
InChIKeyATPWCBUPVVFSTB-UHFFFAOYSA-N
SMILESC1CCC(CC1)(CC(=O)OCC2=CC=CC=C2)CN.Cl

Computed by PubChem (NCBI)