CAS 1951438-90-6 is the registry number for Isopropyl 2-bromo-5-(2-methyl-1,3-dioxolan-2-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Propan-2-yl 2-bromo-5-(2-methyl-1,3-dioxolan-2-yl)benzoate (CAS 1951438-90-6) is a chemical compound with the molecular formula C14H17BrO4 and a molecular weight of 329.19 g/mol. IUPAC name: propan-2-yl 2-bromo-5-(2-methyl-1,3-dioxolan-2-yl)benzoate. InChIKey: SGPGEUVMBBCUNE-UHFFFAOYSA-N.
| Molecular formula | C14H17BrO4 |
|---|---|
| Molecular weight | 329.19 g/mol |
| IUPAC name | propan-2-yl 2-bromo-5-(2-methyl-1,3-dioxolan-2-yl)benzoate |
| InChIKey | SGPGEUVMBBCUNE-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=C(C=CC(=C1)C2(OCCO2)C)Br |
Computed by PubChem (NCBI)