Products 2615912-69-9
CAS 2615912-69-9 is the registry number for (R)-2-(3-Bromophenyl)-4-(tert-butoxy)-4-oxobutanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(3-bromophenyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 2615912-69-9) is a chemical compound with the molecular formula C14H17BrO4 and a molecular weight of 329.19 g/mol. IUPAC name: (2R)-2-(3-bromophenyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: AQGGJHUVXHOZEL-LLVKDONJSA-N.
| Molecular formula | C14H17BrO4 |
|---|---|
| Molecular weight | 329.19 g/mol |
| IUPAC name | (2R)-2-(3-bromophenyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | AQGGJHUVXHOZEL-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@H](C1=CC(=CC=C1)Br)C(=O)O |
Computed by PubChem (NCBI)