Products 1951439-12-5
CAS 1951439-12-5 appears in our catalog under these names: Trans-benzyl 3-amino-4-methylpiperidine-1-carboxylate hydrochloride, 95%, trans-benzyl 3-amino-4-methylpiperidine-1-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
Benzyl (3S,4R)-3-amino-4-methylpiperidine-1-carboxylate;hydrochloride (CAS 1951439-12-5) is a chemical compound with the molecular formula C14H21ClN2O2 and a molecular weight of 284.78 g/mol. IUPAC name: benzyl (3S,4R)-3-amino-4-methylpiperidine-1-carboxylate;hydrochloride. InChIKey: MMJLWUJXQMYCPX-LOCPCMAASA-N.
| Molecular formula | C14H21ClN2O2 |
|---|---|
| Molecular weight | 284.78 g/mol |
| IUPAC name | benzyl (3S,4R)-3-amino-4-methylpiperidine-1-carboxylate;hydrochloride |
| InChIKey | MMJLWUJXQMYCPX-LOCPCMAASA-N |
| SMILES | C[C@@H]1CCN(C[C@H]1N)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)