Products 1951439-40-9

CAS 1951439-40-9 is the registry number for 3-Fluoro-2-methoxyaniline hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 100g, 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

3-fluoro-2-methoxyaniline;hydrochloride (CAS 1951439-40-9) is a chemical compound with the molecular formula C7H9ClFNO and a molecular weight of 177.60 g/mol. IUPAC name: 3-fluoro-2-methoxyaniline;hydrochloride. InChIKey: IWUALJJVQWVBSN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9ClFNO
Molecular weight177.60 g/mol
IUPAC name3-fluoro-2-methoxyaniline;hydrochloride
InChIKeyIWUALJJVQWVBSN-UHFFFAOYSA-N
SMILESCOC1=C(C=CC=C1F)N.Cl

Computed by PubChem (NCBI)