Products 326-83-0

CAS 326-83-0 is the registry number for 5-Fluoro-2-methoxyaniline hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 5g, 1g.

Structural formula: {0} (CAS {1})

5-fluoro-2-methoxyaniline;hydrochloride (CAS 326-83-0) is a chemical compound with the molecular formula C7H9ClFNO and a molecular weight of 177.60 g/mol. IUPAC name: 5-fluoro-2-methoxyaniline;hydrochloride. InChIKey: KZXVFYUNWRUFBB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9ClFNO
Molecular weight177.60 g/mol
IUPAC name5-fluoro-2-methoxyaniline;hydrochloride
InChIKeyKZXVFYUNWRUFBB-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)F)N.Cl

Computed by PubChem (NCBI)