CAS 1951441-99-8 is the registry number for 2-Morpholino-3-(2,2,2-trifluoroacetyl)-4h-benzo[h]chromen-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg.
2-morpholin-4-yl-3-(2,2,2-trifluoroacetyl)benzo[h]chromen-4-one (CAS 1951441-99-8) is a chemical compound with the molecular formula C19H14F3NO4 and a molecular weight of 377.3 g/mol. IUPAC name: 2-morpholin-4-yl-3-(2,2,2-trifluoroacetyl)benzo[h]chromen-4-one. InChIKey: JLSOGEJHNCDMSW-UHFFFAOYSA-N.
| Molecular formula | C19H14F3NO4 |
|---|---|
| Molecular weight | 377.3 g/mol |
| IUPAC name | 2-morpholin-4-yl-3-(2,2,2-trifluoroacetyl)benzo[h]chromen-4-one |
| InChIKey | JLSOGEJHNCDMSW-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C(=O)C3=C(O2)C4=CC=CC=C4C=C3)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)