CAS 3028731-23-6 is the registry number for HPPD-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[hydroxy-[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methylidene]cyclohexane-1,3-dione (CAS 3028731-23-6) is a chemical compound with the molecular formula C19H14F3NO4 and a molecular weight of 377.3 g/mol. IUPAC name: 2-[hydroxy-[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methylidene]cyclohexane-1,3-dione. InChIKey: DVWIQSGZSCENBF-UHFFFAOYSA-N.
| Molecular formula | C19H14F3NO4 |
|---|---|
| Molecular weight | 377.3 g/mol |
| IUPAC name | 2-[hydroxy-[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methylidene]cyclohexane-1,3-dione |
| InChIKey | DVWIQSGZSCENBF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C(=C(C2=CN=C(C=C2)OC3=CC=CC(=C3)C(F)(F)F)O)C(=O)C1 |
Computed by PubChem (NCBI)