CAS 1951442-09-3 is the registry number for Racemic-(2s,3r)-tert-butyl 3-amino-2-phenylpyrrolidine-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl (2S,3R)-3-amino-2-phenylpyrrolidine-1-carboxylate (CAS 1951442-09-3) is a chemical compound with the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. IUPAC name: tert-butyl (2S,3R)-3-amino-2-phenylpyrrolidine-1-carboxylate. InChIKey: MJKHGPRFYGGNRF-OLZOCXBDSA-N.
| Molecular formula | C15H22N2O2 |
|---|---|
| Molecular weight | 262.35 g/mol |
| IUPAC name | tert-butyl (2S,3R)-3-amino-2-phenylpyrrolidine-1-carboxylate |
| InChIKey | MJKHGPRFYGGNRF-OLZOCXBDSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@@H]1C2=CC=CC=C2)N |
Computed by PubChem (NCBI)