Products 195389-97-0
CAS 195389-97-0 appears in our catalog under these names: N-(3-Bromophenyl)-2,2-dimethylpropanamide, 95%, N-(3-Bromophenyl)-2,2-dimethylpropanamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
N-(3-bromophenyl)-2,2-dimethylpropanamide (CAS 195389-97-0) is a chemical compound with the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. IUPAC name: N-(3-bromophenyl)-2,2-dimethylpropanamide. InChIKey: LIJYXDKEMCTTAV-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | N-(3-bromophenyl)-2,2-dimethylpropanamide |
| InChIKey | LIJYXDKEMCTTAV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)