Products 1954-81-0
CAS 1954-81-0 is the registry number for Chloramben (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 3-amino-2,5-dichlorobenzoate (CAS 1954-81-0) is a chemical compound with the molecular formula C7H4Cl2NNaO2 and a molecular weight of 228.00 g/mol. IUPAC name: sodium 3-amino-2,5-dichlorobenzoate. InChIKey: WMWBBXKLYSGKDY-UHFFFAOYSA-M.
| Molecular formula | C7H4Cl2NNaO2 |
|---|---|
| Molecular weight | 228.00 g/mol |
| IUPAC name | sodium 3-amino-2,5-dichlorobenzoate |
| InChIKey | WMWBBXKLYSGKDY-UHFFFAOYSA-M |
| SMILES | C1=C(C=C(C(=C1C(=O)[O-])Cl)N)Cl.[Na+] |
Computed by PubChem (NCBI)
Synonyms:
Amiben sodium salt, 3-Amino-2,5-dichlorobenzoic acid sodium salt, Chloramben-sodium, Chloramben, sodium salt, Chloramben-sodium [ISO], Sodium 3-amino-2,5-dichlorobenzoate, sodium;3-amino-2,5-dichlorobenzoate, Benzoic acid, 3-amino-2,5-dichloro-, monosodium salt, Sodium chloramben, Caswell No. 168D