CAS 2060020-68-8 is the registry number for Sodium 2-(3,5-dichloropyridin-2-yl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Sodium 2-(3,5-dichloro-2-pyridinyl)acetate (CAS 2060020-68-8) is a chemical compound with the molecular formula C7H4Cl2NNaO2 and a molecular weight of 228.00 g/mol. IUPAC name: sodium 2-(3,5-dichloro-2-pyridinyl)acetate. InChIKey: LECNYPQCBDWXES-UHFFFAOYSA-M.
| Molecular formula | C7H4Cl2NNaO2 |
|---|---|
| Molecular weight | 228.00 g/mol |
| IUPAC name | sodium 2-(3,5-dichloro-2-pyridinyl)acetate |
| InChIKey | LECNYPQCBDWXES-UHFFFAOYSA-M |
| SMILES | C1=C(C=NC(=C1Cl)CC(=O)[O-])Cl.[Na+] |
Computed by PubChem (NCBI)