Products 19542-59-7
CAS 19542-59-7 appears in our catalog under these names: δ8–THCQ, Δ8-Tetrahydrocannabinoquinone. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg.
(6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-1,4-dione (CAS 19542-59-7) is a chemical compound with the molecular formula C21H28O3 and a molecular weight of 328.4 g/mol. IUPAC name: (6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-1,4-dione. InChIKey: GOZGLSHDDOJPJS-HZPDHXFCSA-N.
| Molecular formula | C21H28O3 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | (6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-1,4-dione |
| InChIKey | GOZGLSHDDOJPJS-HZPDHXFCSA-N |
| SMILES | CCCCCC1=CC(=O)C2=C(C1=O)OC([C@H]3[C@H]2CC(=CC3)C)(C)C |
Computed by PubChem (NCBI)