CAS 1954362-67-4 is the registry number for Methyl 6,7-difluorobenzo[b]thiophene-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6,7-difluoro-1-benzothiophene-2-carboxylate (CAS 1954362-67-4) is a chemical compound with the molecular formula C10H6F2O2S and a molecular weight of 228.22 g/mol. IUPAC name: methyl 6,7-difluoro-1-benzothiophene-2-carboxylate. InChIKey: AKMVBVDANUKAAD-UHFFFAOYSA-N.
| Molecular formula | C10H6F2O2S |
|---|---|
| Molecular weight | 228.22 g/mol |
| IUPAC name | methyl 6,7-difluoro-1-benzothiophene-2-carboxylate |
| InChIKey | AKMVBVDANUKAAD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)C(=C(C=C2)F)F |
Computed by PubChem (NCBI)